C24H19N15OS — CID 141026541
2-[2-(1H-imidazol-2-yl)-5-(1H-pyrazol-5-yl)-4-(1H-pyrrol-2-yl)-4-(2H-tetrazol-5-yl)-5-thiophen-2-yl-3-(1H-1,2,4-triazol-5-yl)oxolan-3-yl]-1,3,5-triazine (PubChem CID 141026541) has the molecular formula C24H19N15OS and a molecular weight of 565.59 g/mol. Its IUPAC name is 2-[2-(1H-imidazol-2-yl)-5-(1H-pyrazol-5-yl)-4-(1H-pyrrol-2-yl)-4-(2H-tetrazol-5-yl)-5-thiophen-2-yl-3-(1H-1,2,4-triazol-5-yl)oxolan-3-yl]-1,3,5-triazine.
| Compound Name | 2-[2-(1H-imidazol-2-yl)-5-(1H-pyrazol-5-yl)-4-(1H-pyrrol-2-yl)-4-(2H-tetrazol-5-yl)-5-thiophen-2-yl-3-(1H-1,2,4-triazol-5-yl)oxolan-3-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 141026541 |
| Molecular Formula | C24H19N15OS |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | 2-[2-(1H-imidazol-2-yl)-5-(1H-pyrazol-5-yl)-4-(1H-pyrrol-2-yl)-4-(2H-tetrazol-5-yl)-5-thiophen-2-yl-3-(1H-1,2,4-triazol-5-yl)oxolan-3-yl]-1,3,5-triazine |
| SMILES | c1c[nH]c(C2(c3nn[nH]n3)C(c3ccn[nH]3)(c3cccs3)OC(c3ncc[nH]3)C2(c2ncncn2)c2ncn[nH]2)c1 |
| InChI | InChI=1S/C24H19N15OS/c1-3-14(26-6-1)23(21-36-38-39-37-21)22(20-31-13-33-35-20,19-29-11-25-12-30-19)17(18-27-8-9-28-18)40-24(23,15-5-7-32-34-15)16-4-2-10-41-16/h1-13,17,26H,(H,27,28)(H,32,34)(H,31,33,35)(H,36,37,38,39) |
| InChIKey | DCKKFIWTZIDNMT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 217.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |