C17H22FN5O2 — CID 141026658
4-(1-tert-butyl-5-fluoro-4-pyridin-4-ylpyrazol-3-yl)piperazine-1-carboxylic acid (PubChem CID 141026658) has the molecular formula C17H22FN5O2 and a molecular weight of 347.39 g/mol. Its IUPAC name is 4-(1-tert-butyl-5-fluoro-4-pyridin-4-ylpyrazol-3-yl)piperazine-1-carboxylic acid.
| Compound Name | 4-(1-tert-butyl-5-fluoro-4-pyridin-4-ylpyrazol-3-yl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 141026658 |
| Molecular Formula | C17H22FN5O2 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 4-(1-tert-butyl-5-fluoro-4-pyridin-4-ylpyrazol-3-yl)piperazine-1-carboxylic acid |
| SMILES | CC(C)(C)n1nc(N2CCN(C(=O)O)CC2)c(-c2ccncc2)c1F |
| InChI | InChI=1S/C17H22FN5O2/c1-17(2,3)23-14(18)13(12-4-6-19-7-5-12)15(20-23)21-8-10-22(11-9-21)16(24)25/h4-7H,8-11H2,1-3H3,(H,24,25) |
| InChIKey | ZYZDPKUKVCOYRT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |