C14H27NO — CID 141026841
2,3-diethyl-2-methylnon-8-enamide (PubChem CID 141026841) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 2,3-diethyl-2-methylnon-8-enamide.
| Compound Name | 2,3-diethyl-2-methylnon-8-enamide |
|---|---|
| PubChem CID | 141026841 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 2,3-diethyl-2-methylnon-8-enamide |
| SMILES | C=CCCCCC(CC)C(C)(CC)C(N)=O |
| InChI | InChI=1S/C14H27NO/c1-5-8-9-10-11-12(6-2)14(4,7-3)13(15)16/h5,12H,1,6-11H2,2-4H3,(H2,15,16) |
| InChIKey | FEVYXBUXPSCIAU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|