About 4-butyl-N,N-dimethyl-1,2,4-triazol-3-amine
4-butyl-N,N-dimethyl-1,2,4-triazol-3-amine (PubChem CID 141027087) has the molecular formula C8H16N4
and a molecular weight of 168.24 g/mol. Its IUPAC name is 4-butyl-N,N-dimethyl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 4-butyl-N,N-dimethyl-1,2,4-triazol-3-amine |
| PubChem CID | 141027087 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 4-butyl-N,N-dimethyl-1,2,4-triazol-3-amine |
| SMILES | CCCCn1cnnc1N(C)C |
| InChI | InChI=1S/C8H16N4/c1-4-5-6-12-7-9-10-8(12)11(2)3/h7H,4-6H2,1-3H3 |
| InChIKey | MIKIEMZRLQAKPQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-butyl-N,N-dimethyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-N,N-dimethyl-1,2,4-triazol-3-amine?
The IUPAC name of 4-butyl-N,N-dimethyl-1,2,4-triazol-3-amine (CID 141027087) is 4-butyl-N,N-dimethyl-1,2,4-triazol-3-amine.
What is the SMILES notation for 4-butyl-N,N-dimethyl-1,2,4-triazol-3-amine?
The canonical SMILES for 4-butyl-N,N-dimethyl-1,2,4-triazol-3-amine is CCCCn1cnnc1N(C)C.
What is the InChIKey of 4-butyl-N,N-dimethyl-1,2,4-triazol-3-amine?
The InChIKey is MIKIEMZRLQAKPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4/c1-4-5-6-12-7-9-10-8(12)11(2)3/h7H,4-6H2,1-3H3.
What are the key properties of 4-butyl-N,N-dimethyl-1,2,4-triazol-3-amine?
4-butyl-N,N-dimethyl-1,2,4-triazol-3-amine has a molecular weight of 168.24 g/mol, XLogP of 1.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-N,N-dimethyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 141027087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).