C18H19NO5S — CID 141027096
[(4-ethoxy-1,4-dioxo-1-thiophen-3-ylbutan-2-yl)amino] 4-methylbenzoate (PubChem CID 141027096) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is [(4-ethoxy-1,4-dioxo-1-thiophen-3-ylbutan-2-yl)amino] 4-methylbenzoate.
| Compound Name | [(4-ethoxy-1,4-dioxo-1-thiophen-3-ylbutan-2-yl)amino] 4-methylbenzoate |
|---|---|
| PubChem CID | 141027096 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | [(4-ethoxy-1,4-dioxo-1-thiophen-3-ylbutan-2-yl)amino] 4-methylbenzoate |
| SMILES | CCOC(=O)CC(NOC(=O)c1ccc(C)cc1)C(=O)c1ccsc1 |
| InChI | InChI=1S/C18H19NO5S/c1-3-23-16(20)10-15(17(21)14-8-9-25-11-14)19-24-18(22)13-6-4-12(2)5-7-13/h4-9,11,15,19H,3,10H2,1-2H3 |
| InChIKey | VPXOCHSAVBDGNS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|