About [(4-ethoxy-1,4-dioxo-1-thiophen-3-ylbutan-2-yl)amino] 4-methylbenzoate
[(4-ethoxy-1,4-dioxo-1-thiophen-3-ylbutan-2-yl)amino] 4-methylbenzoate (PubChem CID 141027096) has the molecular formula C18H19NO5S
and a molecular weight of 361.42 g/mol. Its IUPAC name is [(4-ethoxy-1,4-dioxo-1-thiophen-3-ylbutan-2-yl)amino] 4-methylbenzoate.
Molecular Properties
| Compound Name | [(4-ethoxy-1,4-dioxo-1-thiophen-3-ylbutan-2-yl)amino] 4-methylbenzoate |
| PubChem CID | 141027096 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | [(4-ethoxy-1,4-dioxo-1-thiophen-3-ylbutan-2-yl)amino] 4-methylbenzoate |
| SMILES | CCOC(=O)CC(NOC(=O)c1ccc(C)cc1)C(=O)c1ccsc1 |
| InChI | InChI=1S/C18H19NO5S/c1-3-23-16(20)10-15(17(21)14-8-9-25-11-14)19-24-18(22)13-6-4-12(2)5-7-13/h4-9,11,15,19H,3,10H2,1-2H3 |
| InChIKey | VPXOCHSAVBDGNS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4-ethoxy-1,4-dioxo-1-thiophen-3-ylbutan-2-yl)amino] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-ethoxy-1,4-dioxo-1-thiophen-3-ylbutan-2-yl)amino] 4-methylbenzoate?
The IUPAC name of [(4-ethoxy-1,4-dioxo-1-thiophen-3-ylbutan-2-yl)amino] 4-methylbenzoate (CID 141027096) is [(4-ethoxy-1,4-dioxo-1-thiophen-3-ylbutan-2-yl)amino] 4-methylbenzoate.
What is the SMILES notation for [(4-ethoxy-1,4-dioxo-1-thiophen-3-ylbutan-2-yl)amino] 4-methylbenzoate?
The canonical SMILES for [(4-ethoxy-1,4-dioxo-1-thiophen-3-ylbutan-2-yl)amino] 4-methylbenzoate is CCOC(=O)CC(NOC(=O)c1ccc(C)cc1)C(=O)c1ccsc1.
What is the InChIKey of [(4-ethoxy-1,4-dioxo-1-thiophen-3-ylbutan-2-yl)amino] 4-methylbenzoate?
The InChIKey is VPXOCHSAVBDGNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO5S/c1-3-23-16(20)10-15(17(21)14-8-9-25-11-14)19-24-18(22)13-6-4-12(2)5-7-13/h4-9,11,15,19H,3,10H2,1-2H3.
What are the key properties of [(4-ethoxy-1,4-dioxo-1-thiophen-3-ylbutan-2-yl)amino] 4-methylbenzoate?
[(4-ethoxy-1,4-dioxo-1-thiophen-3-ylbutan-2-yl)amino] 4-methylbenzoate has a molecular weight of 361.42 g/mol, XLogP of 2.92, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-ethoxy-1,4-dioxo-1-thiophen-3-ylbutan-2-yl)amino] 4-methylbenzoate is sourced from PubChem (CID 141027096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).