About 6-butylperoxy-10-ethoxy-6-methoxy-10-propoxyhexadeca-4,11-diene
6-butylperoxy-10-ethoxy-6-methoxy-10-propoxyhexadeca-4,11-diene (PubChem CID 141027194) has the molecular formula C26H50O5
and a molecular weight of 442.68 g/mol. Its IUPAC name is 6-butylperoxy-10-ethoxy-6-methoxy-10-propoxyhexadeca-4,11-diene.
Molecular Properties
| Compound Name | 6-butylperoxy-10-ethoxy-6-methoxy-10-propoxyhexadeca-4,11-diene |
| PubChem CID | 141027194 |
| Molecular Formula | C26H50O5 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.37 |
| IUPAC Name | 6-butylperoxy-10-ethoxy-6-methoxy-10-propoxyhexadeca-4,11-diene |
| SMILES | CCCC=CC(CCCC(C=CCCCC)(OCC)OCCC)(OC)OOCCCC |
| InChI | InChI=1S/C26H50O5/c1-7-12-15-17-20-26(28-11-5,29-23-10-4)22-18-21-25(27-6,19-16-13-8-2)31-30-24-14-9-3/h16-17,19-20H,7-15,18,21-24H2,1-6H3 |
| InChIKey | OYSCJDQITYYIRT-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 6-butylperoxy-10-ethoxy-6-methoxy-10-propoxyhexadeca-4,11-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butylperoxy-10-ethoxy-6-methoxy-10-propoxyhexadeca-4,11-diene?
The IUPAC name of 6-butylperoxy-10-ethoxy-6-methoxy-10-propoxyhexadeca-4,11-diene (CID 141027194) is 6-butylperoxy-10-ethoxy-6-methoxy-10-propoxyhexadeca-4,11-diene.
What is the SMILES notation for 6-butylperoxy-10-ethoxy-6-methoxy-10-propoxyhexadeca-4,11-diene?
The canonical SMILES for 6-butylperoxy-10-ethoxy-6-methoxy-10-propoxyhexadeca-4,11-diene is CCCC=CC(CCCC(C=CCCCC)(OCC)OCCC)(OC)OOCCCC.
What is the InChIKey of 6-butylperoxy-10-ethoxy-6-methoxy-10-propoxyhexadeca-4,11-diene?
The InChIKey is OYSCJDQITYYIRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H50O5/c1-7-12-15-17-20-26(28-11-5,29-23-10-4)22-18-21-25(27-6,19-16-13-8-2)31-30-24-14-9-3/h16-17,19-20H,7-15,18,21-24H2,1-6H3.
What are the key properties of 6-butylperoxy-10-ethoxy-6-methoxy-10-propoxyhexadeca-4,11-diene?
6-butylperoxy-10-ethoxy-6-methoxy-10-propoxyhexadeca-4,11-diene has a molecular weight of 442.68 g/mol, XLogP of 7.51, 22 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butylperoxy-10-ethoxy-6-methoxy-10-propoxyhexadeca-4,11-diene is sourced from PubChem (CID 141027194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).