C15H15F3N2O3 — CID 141027256
5-[1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]oxypentanoic acid (PubChem CID 141027256) has the molecular formula C15H15F3N2O3 and a molecular weight of 328.29 g/mol. Its IUPAC name is 5-[1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]oxypentanoic acid.
| Compound Name | 5-[1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]oxypentanoic acid |
|---|---|
| PubChem CID | 141027256 |
| Molecular Formula | C15H15F3N2O3 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 5-[1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]oxypentanoic acid |
| SMILES | O=C(O)CCCCOc1cc(C(F)(F)F)nn1-c1ccccc1 |
| InChI | InChI=1S/C15H15F3N2O3/c16-15(17,18)12-10-13(23-9-5-4-8-14(21)22)20(19-12)11-6-2-1-3-7-11/h1-3,6-7,10H,4-5,8-9H2,(H,21,22) |
| InChIKey | HIXMRTWDJTWWBS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|