C5H8OS2 — CID 141027770
(2-methyl-1,3-dithiol-4-yl)methanol (PubChem CID 141027770) has the molecular formula C5H8OS2 and a molecular weight of 148.25 g/mol. Its IUPAC name is (2-methyl-1,3-dithiol-4-yl)methanol.
| Compound Name | (2-methyl-1,3-dithiol-4-yl)methanol |
|---|---|
| PubChem CID | 141027770 |
| Molecular Formula | C5H8OS2 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.00 |
| IUPAC Name | (2-methyl-1,3-dithiol-4-yl)methanol |
| SMILES | CC1SC=C(CO)S1 |
| InChI | InChI=1S/C5H8OS2/c1-4-7-3-5(2-6)8-4/h3-4,6H,2H2,1H3 |
| InChIKey | ICCRQFGEHULUMC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |