About S-[3-(2-naphthalen-1-yl-1,3-dithiol-4-yl)propyl] prop-2-enethioate
S-[3-(2-naphthalen-1-yl-1,3-dithiol-4-yl)propyl] prop-2-enethioate (PubChem CID 141027803) has the molecular formula C19H18OS3
and a molecular weight of 358.55 g/mol. Its IUPAC name is S-[3-(2-naphthalen-1-yl-1,3-dithiol-4-yl)propyl] prop-2-enethioate.
Molecular Properties
| Compound Name | S-[3-(2-naphthalen-1-yl-1,3-dithiol-4-yl)propyl] prop-2-enethioate |
| PubChem CID | 141027803 |
| Molecular Formula | C19H18OS3 |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | S-[3-(2-naphthalen-1-yl-1,3-dithiol-4-yl)propyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCCCC1=CSC(c2cccc3ccccc23)S1 |
| InChI | InChI=1S/C19H18OS3/c1-2-18(20)21-12-6-9-15-13-22-19(23-15)17-11-5-8-14-7-3-4-10-16(14)17/h2-5,7-8,10-11,13,19H,1,6,9,12H2 |
| InChIKey | PMVNNOAGONKFSP-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[3-(2-naphthalen-1-yl-1,3-dithiol-4-yl)propyl] prop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[3-(2-naphthalen-1-yl-1,3-dithiol-4-yl)propyl] prop-2-enethioate?
The IUPAC name of S-[3-(2-naphthalen-1-yl-1,3-dithiol-4-yl)propyl] prop-2-enethioate (CID 141027803) is S-[3-(2-naphthalen-1-yl-1,3-dithiol-4-yl)propyl] prop-2-enethioate.
What is the SMILES notation for S-[3-(2-naphthalen-1-yl-1,3-dithiol-4-yl)propyl] prop-2-enethioate?
The canonical SMILES for S-[3-(2-naphthalen-1-yl-1,3-dithiol-4-yl)propyl] prop-2-enethioate is C=CC(=O)SCCCC1=CSC(c2cccc3ccccc23)S1.
What is the InChIKey of S-[3-(2-naphthalen-1-yl-1,3-dithiol-4-yl)propyl] prop-2-enethioate?
The InChIKey is PMVNNOAGONKFSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18OS3/c1-2-18(20)21-12-6-9-15-13-22-19(23-15)17-11-5-8-14-7-3-4-10-16(14)17/h2-5,7-8,10-11,13,19H,1,6,9,12H2.
What are the key properties of S-[3-(2-naphthalen-1-yl-1,3-dithiol-4-yl)propyl] prop-2-enethioate?
S-[3-(2-naphthalen-1-yl-1,3-dithiol-4-yl)propyl] prop-2-enethioate has a molecular weight of 358.55 g/mol, XLogP of 6.39, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[3-(2-naphthalen-1-yl-1,3-dithiol-4-yl)propyl] prop-2-enethioate is sourced from PubChem (CID 141027803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).