About S-[(2,2-diphenyl-1,3-dithiol-4-yl)methyl] prop-2-enethioate
S-[(2,2-diphenyl-1,3-dithiol-4-yl)methyl] prop-2-enethioate (PubChem CID 141027822) has the molecular formula C19H16OS3
and a molecular weight of 356.54 g/mol. Its IUPAC name is S-[(2,2-diphenyl-1,3-dithiol-4-yl)methyl] prop-2-enethioate.
Molecular Properties
| Compound Name | S-[(2,2-diphenyl-1,3-dithiol-4-yl)methyl] prop-2-enethioate |
| PubChem CID | 141027822 |
| Molecular Formula | C19H16OS3 |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | S-[(2,2-diphenyl-1,3-dithiol-4-yl)methyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCC1=CSC(c2ccccc2)(c2ccccc2)S1 |
| InChI | InChI=1S/C19H16OS3/c1-2-18(20)21-13-17-14-22-19(23-17,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h2-12,14H,1,13H2 |
| InChIKey | UIBZIDNZKBYDDO-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(2,2-diphenyl-1,3-dithiol-4-yl)methyl] prop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(2,2-diphenyl-1,3-dithiol-4-yl)methyl] prop-2-enethioate?
The IUPAC name of S-[(2,2-diphenyl-1,3-dithiol-4-yl)methyl] prop-2-enethioate (CID 141027822) is S-[(2,2-diphenyl-1,3-dithiol-4-yl)methyl] prop-2-enethioate.
What is the SMILES notation for S-[(2,2-diphenyl-1,3-dithiol-4-yl)methyl] prop-2-enethioate?
The canonical SMILES for S-[(2,2-diphenyl-1,3-dithiol-4-yl)methyl] prop-2-enethioate is C=CC(=O)SCC1=CSC(c2ccccc2)(c2ccccc2)S1.
What is the InChIKey of S-[(2,2-diphenyl-1,3-dithiol-4-yl)methyl] prop-2-enethioate?
The InChIKey is UIBZIDNZKBYDDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16OS3/c1-2-18(20)21-13-17-14-22-19(23-17,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h2-12,14H,1,13H2.
What are the key properties of S-[(2,2-diphenyl-1,3-dithiol-4-yl)methyl] prop-2-enethioate?
S-[(2,2-diphenyl-1,3-dithiol-4-yl)methyl] prop-2-enethioate has a molecular weight of 356.54 g/mol, XLogP of 5.65, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(2,2-diphenyl-1,3-dithiol-4-yl)methyl] prop-2-enethioate is sourced from PubChem (CID 141027822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).