About 1,2-dihydroxy-6-triethoxysilylhexan-3-one;hydrate
1,2-dihydroxy-6-triethoxysilylhexan-3-one;hydrate (PubChem CID 141028151) has the molecular formula C12H28O7Si
and a molecular weight of 312.44 g/mol. Its IUPAC name is 1,2-dihydroxy-6-triethoxysilylhexan-3-one;hydrate.
Molecular Properties
| Compound Name | 1,2-dihydroxy-6-triethoxysilylhexan-3-one;hydrate |
| PubChem CID | 141028151 |
| Molecular Formula | C12H28O7Si |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1,2-dihydroxy-6-triethoxysilylhexan-3-one;hydrate |
| SMILES | CCO[Si](CCCC(=O)C(O)CO)(OCC)OCC.O |
| InChI | InChI=1S/C12H26O6Si.H2O/c1-4-16-19(17-5-2,18-6-3)9-7-8-11(14)12(15)10-13;/h12-13,15H,4-10H2,1-3H3;1H2 |
| InChIKey | LUNJBDPXHBFFBF-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dihydroxy-6-triethoxysilylhexan-3-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydroxy-6-triethoxysilylhexan-3-one;hydrate?
The IUPAC name of 1,2-dihydroxy-6-triethoxysilylhexan-3-one;hydrate (CID 141028151) is 1,2-dihydroxy-6-triethoxysilylhexan-3-one;hydrate.
What is the SMILES notation for 1,2-dihydroxy-6-triethoxysilylhexan-3-one;hydrate?
The canonical SMILES for 1,2-dihydroxy-6-triethoxysilylhexan-3-one;hydrate is CCO[Si](CCCC(=O)C(O)CO)(OCC)OCC.O.
What is the InChIKey of 1,2-dihydroxy-6-triethoxysilylhexan-3-one;hydrate?
The InChIKey is LUNJBDPXHBFFBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O6Si.H2O/c1-4-16-19(17-5-2,18-6-3)9-7-8-11(14)12(15)10-13;/h12-13,15H,4-10H2,1-3H3;1H2.
What are the key properties of 1,2-dihydroxy-6-triethoxysilylhexan-3-one;hydrate?
1,2-dihydroxy-6-triethoxysilylhexan-3-one;hydrate has a molecular weight of 312.44 g/mol, XLogP of -0.09, 12 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydroxy-6-triethoxysilylhexan-3-one;hydrate is sourced from PubChem (CID 141028151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).