C14H12Cl3NOS — CID 141029178
2-(5-amino-2,3-dichlorophenyl)sulfanyl-1-phenylethanone;hydrochloride (PubChem CID 141029178) has the molecular formula C14H12Cl3NOS and a molecular weight of 348.68 g/mol. Its IUPAC name is 2-(5-amino-2,3-dichlorophenyl)sulfanyl-1-phenylethanone;hydrochloride.
| Compound Name | 2-(5-amino-2,3-dichlorophenyl)sulfanyl-1-phenylethanone;hydrochloride |
|---|---|
| PubChem CID | 141029178 |
| Molecular Formula | C14H12Cl3NOS |
| Molecular Weight | 348.68 g/mol |
| Exact Mass | 346.97 |
| IUPAC Name | 2-(5-amino-2,3-dichlorophenyl)sulfanyl-1-phenylethanone;hydrochloride |
| SMILES | Cl.Nc1cc(Cl)c(Cl)c(SCC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C14H11Cl2NOS.ClH/c15-11-6-10(17)7-13(14(11)16)19-8-12(18)9-4-2-1-3-5-9;/h1-7H,8,17H2;1H |
| InChIKey | ASFIWQCQTAPHEW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|