About [1-[(1S,3S)-3-azidocyclopentyl]-5-fluoroindol-3-yl] cyanate
[1-[(1S,3S)-3-azidocyclopentyl]-5-fluoroindol-3-yl] cyanate (PubChem CID 141029279) has the molecular formula C14H12FN5O
and a molecular weight of 285.28 g/mol. Its IUPAC name is [1-[(1S,3S)-3-azidocyclopentyl]-5-fluoroindol-3-yl] cyanate.
Molecular Properties
| Compound Name | [1-[(1S,3S)-3-azidocyclopentyl]-5-fluoroindol-3-yl] cyanate |
| PubChem CID | 141029279 |
| Molecular Formula | C14H12FN5O |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | [1-[(1S,3S)-3-azidocyclopentyl]-5-fluoroindol-3-yl] cyanate |
| SMILES | N#COc1cn([C@H]2CC[C@H](N=[N+]=[N-])C2)c2ccc(F)cc12 |
| InChI | InChI=1S/C14H12FN5O/c15-9-1-4-13-12(5-9)14(21-8-16)7-20(13)11-3-2-10(6-11)18-19-17/h1,4-5,7,10-11H,2-3,6H2/t10-,11-/m0/s1 |
| InChIKey | LYSGSXZFLULTRN-QWRGUYRKSA-N |
| XLogP | 4.04 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [1-[(1S,3S)-3-azidocyclopentyl]-5-fluoroindol-3-yl] cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(1S,3S)-3-azidocyclopentyl]-5-fluoroindol-3-yl] cyanate?
The IUPAC name of [1-[(1S,3S)-3-azidocyclopentyl]-5-fluoroindol-3-yl] cyanate (CID 141029279) is [1-[(1S,3S)-3-azidocyclopentyl]-5-fluoroindol-3-yl] cyanate.
What is the SMILES notation for [1-[(1S,3S)-3-azidocyclopentyl]-5-fluoroindol-3-yl] cyanate?
The canonical SMILES for [1-[(1S,3S)-3-azidocyclopentyl]-5-fluoroindol-3-yl] cyanate is N#COc1cn([C@H]2CC[C@H](N=[N+]=[N-])C2)c2ccc(F)cc12.
What is the InChIKey of [1-[(1S,3S)-3-azidocyclopentyl]-5-fluoroindol-3-yl] cyanate?
The InChIKey is LYSGSXZFLULTRN-QWRGUYRKSA-N. The full InChI is InChI=1S/C14H12FN5O/c15-9-1-4-13-12(5-9)14(21-8-16)7-20(13)11-3-2-10(6-11)18-19-17/h1,4-5,7,10-11H,2-3,6H2/t10-,11-/m0/s1.
What are the key properties of [1-[(1S,3S)-3-azidocyclopentyl]-5-fluoroindol-3-yl] cyanate?
[1-[(1S,3S)-3-azidocyclopentyl]-5-fluoroindol-3-yl] cyanate has a molecular weight of 285.28 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(1S,3S)-3-azidocyclopentyl]-5-fluoroindol-3-yl] cyanate is sourced from PubChem (CID 141029279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).