About N-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide
N-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide (PubChem CID 141029507) has the molecular formula C6H10N2O3S
and a molecular weight of 190.22 g/mol. Its IUPAC name is N-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide.
Molecular Properties
| Compound Name | N-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide |
| PubChem CID | 141029507 |
| Molecular Formula | C6H10N2O3S |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | N-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide |
| SMILES | O=C(CS)NC[C@H]1CNC(=O)O1 |
| InChI | InChI=1S/C6H10N2O3S/c9-5(3-12)7-1-4-2-8-6(10)11-4/h4,12H,1-3H2,(H,7,9)(H,8,10)/t4-/m0/s1 |
| InChIKey | HSBRDACPHJMYQW-BYPYZUCNSA-N |
| XLogP | -0.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide?
The IUPAC name of N-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide (CID 141029507) is N-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide.
What is the SMILES notation for N-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide?
The canonical SMILES for N-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide is O=C(CS)NC[C@H]1CNC(=O)O1.
What is the InChIKey of N-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide?
The InChIKey is HSBRDACPHJMYQW-BYPYZUCNSA-N. The full InChI is InChI=1S/C6H10N2O3S/c9-5(3-12)7-1-4-2-8-6(10)11-4/h4,12H,1-3H2,(H,7,9)(H,8,10)/t4-/m0/s1.
What are the key properties of N-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide?
N-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide has a molecular weight of 190.22 g/mol, XLogP of -0.86, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide is sourced from PubChem (CID 141029507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).