About methyl 4-[(2,4,6-trimethoxyphenyl)methylamino]quinazoline-6-carboxylate
methyl 4-[(2,4,6-trimethoxyphenyl)methylamino]quinazoline-6-carboxylate (PubChem CID 141030833) has the molecular formula C20H21N3O5
and a molecular weight of 383.40 g/mol. Its IUPAC name is methyl 4-[(2,4,6-trimethoxyphenyl)methylamino]quinazoline-6-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[(2,4,6-trimethoxyphenyl)methylamino]quinazoline-6-carboxylate |
| PubChem CID | 141030833 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | methyl 4-[(2,4,6-trimethoxyphenyl)methylamino]quinazoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2ncnc(NCc3c(OC)cc(OC)cc3OC)c2c1 |
| InChI | InChI=1S/C20H21N3O5/c1-25-13-8-17(26-2)15(18(9-13)27-3)10-21-19-14-7-12(20(24)28-4)5-6-16(14)22-11-23-19/h5-9,11H,10H2,1-4H3,(H,21,22,23) |
| InChIKey | AWAUWKRTKOXHRH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 4-[(2,4,6-trimethoxyphenyl)methylamino]quinazoline-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(2,4,6-trimethoxyphenyl)methylamino]quinazoline-6-carboxylate?
The IUPAC name of methyl 4-[(2,4,6-trimethoxyphenyl)methylamino]quinazoline-6-carboxylate (CID 141030833) is methyl 4-[(2,4,6-trimethoxyphenyl)methylamino]quinazoline-6-carboxylate.
What is the SMILES notation for methyl 4-[(2,4,6-trimethoxyphenyl)methylamino]quinazoline-6-carboxylate?
The canonical SMILES for methyl 4-[(2,4,6-trimethoxyphenyl)methylamino]quinazoline-6-carboxylate is COC(=O)c1ccc2ncnc(NCc3c(OC)cc(OC)cc3OC)c2c1.
What is the InChIKey of methyl 4-[(2,4,6-trimethoxyphenyl)methylamino]quinazoline-6-carboxylate?
The InChIKey is AWAUWKRTKOXHRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O5/c1-25-13-8-17(26-2)15(18(9-13)27-3)10-21-19-14-7-12(20(24)28-4)5-6-16(14)22-11-23-19/h5-9,11H,10H2,1-4H3,(H,21,22,23).
What are the key properties of methyl 4-[(2,4,6-trimethoxyphenyl)methylamino]quinazoline-6-carboxylate?
methyl 4-[(2,4,6-trimethoxyphenyl)methylamino]quinazoline-6-carboxylate has a molecular weight of 383.40 g/mol, XLogP of 3.05, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2,4,6-trimethoxyphenyl)methylamino]quinazoline-6-carboxylate is sourced from PubChem (CID 141030833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).