C20H21N3O5 — CID 141030833
methyl 4-[(2,4,6-trimethoxyphenyl)methylamino]quinazoline-6-carboxylate (PubChem CID 141030833) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is methyl 4-[(2,4,6-trimethoxyphenyl)methylamino]quinazoline-6-carboxylate.
| Compound Name | methyl 4-[(2,4,6-trimethoxyphenyl)methylamino]quinazoline-6-carboxylate |
|---|---|
| PubChem CID | 141030833 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | methyl 4-[(2,4,6-trimethoxyphenyl)methylamino]quinazoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2ncnc(NCc3c(OC)cc(OC)cc3OC)c2c1 |
| InChI | InChI=1S/C20H21N3O5/c1-25-13-8-17(26-2)15(18(9-13)27-3)10-21-19-14-7-12(20(24)28-4)5-6-16(14)22-11-23-19/h5-9,11H,10H2,1-4H3,(H,21,22,23) |
| InChIKey | AWAUWKRTKOXHRH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |