C18H26NO5PS — CID 14103088
(2S,4S)-1-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]-4-methylsulfanylpyrrolidine-2-carboxylic acid (PubChem CID 14103088) has the molecular formula C18H26NO5PS and a molecular weight of 399.45 g/mol. Its IUPAC name is (2S,4S)-1-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]-4-methylsulfanylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-1-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]-4-methylsulfanylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 14103088 |
| Molecular Formula | C18H26NO5PS |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | (2S,4S)-1-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]-4-methylsulfanylpyrrolidine-2-carboxylic acid |
| SMILES | CS[C@H]1C[C@@H](C(=O)O)N(C(=O)CP(=O)(O)CCCCc2ccccc2)C1 |
| InChI | InChI=1S/C18H26NO5PS/c1-26-15-11-16(18(21)22)19(12-15)17(20)13-25(23,24)10-6-5-9-14-7-3-2-4-8-14/h2-4,7-8,15-16H,5-6,9-13H2,1H3,(H,21,22)(H,23,24)/t15-,16-/m0/s1 |
| InChIKey | JYQRBOCGMCVLMP-HOTGVXAUSA-N |
| XLogP | 2.70 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|