C23H28NO5PS — CID 14103092
(2S,4S)-1-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]-4-phenylsulfanylpyrrolidine-2-carboxylic acid (PubChem CID 14103092) has the molecular formula C23H28NO5PS and a molecular weight of 461.52 g/mol. Its IUPAC name is (2S,4S)-1-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]-4-phenylsulfanylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-1-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]-4-phenylsulfanylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 14103092 |
| Molecular Formula | C23H28NO5PS |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | (2S,4S)-1-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]-4-phenylsulfanylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H](Sc2ccccc2)CN1C(=O)CP(=O)(O)CCCCc1ccccc1 |
| InChI | InChI=1S/C23H28NO5PS/c25-22(17-30(28,29)14-8-7-11-18-9-3-1-4-10-18)24-16-20(15-21(24)23(26)27)31-19-12-5-2-6-13-19/h1-6,9-10,12-13,20-21H,7-8,11,14-17H2,(H,26,27)(H,28,29)/t20-,21-/m0/s1 |
| InChIKey | VMIBUXWCIYBLHI-SFTDATJTSA-N |
| XLogP | 4.13 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|