About pyrrolo[2,1-b][1,3]thiazole;hydrobromide
pyrrolo[2,1-b][1,3]thiazole;hydrobromide (PubChem CID 141031142) has the molecular formula C6H6BrNS
and a molecular weight of 204.09 g/mol. Its IUPAC name is pyrrolo[2,1-b][1,3]thiazole;hydrobromide.
Molecular Properties
| Compound Name | pyrrolo[2,1-b][1,3]thiazole;hydrobromide |
| PubChem CID | 141031142 |
| Molecular Formula | C6H6BrNS |
| Molecular Weight | 204.09 g/mol |
| Exact Mass | 202.94 |
| IUPAC Name | pyrrolo[2,1-b][1,3]thiazole;hydrobromide |
| SMILES | Br.c1cc2sccn2c1 |
| InChI | InChI=1S/C6H5NS.BrH/c1-2-6-7(3-1)4-5-8-6;/h1-5H;1H |
| InChIKey | YMUYKSJFENQWSL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.09 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrrolo[2,1-b][1,3]thiazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[2,1-b][1,3]thiazole;hydrobromide?
The IUPAC name of pyrrolo[2,1-b][1,3]thiazole;hydrobromide (CID 141031142) is pyrrolo[2,1-b][1,3]thiazole;hydrobromide.
What is the SMILES notation for pyrrolo[2,1-b][1,3]thiazole;hydrobromide?
The canonical SMILES for pyrrolo[2,1-b][1,3]thiazole;hydrobromide is Br.c1cc2sccn2c1.
What is the InChIKey of pyrrolo[2,1-b][1,3]thiazole;hydrobromide?
The InChIKey is YMUYKSJFENQWSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NS.BrH/c1-2-6-7(3-1)4-5-8-6;/h1-5H;1H.
What are the key properties of pyrrolo[2,1-b][1,3]thiazole;hydrobromide?
pyrrolo[2,1-b][1,3]thiazole;hydrobromide has a molecular weight of 204.09 g/mol, XLogP of 2.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[2,1-b][1,3]thiazole;hydrobromide is sourced from PubChem (CID 141031142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).