C9H18N4 — CID 141031580
3-methyl-5-(2-methylpropyl)-3,4,7,8-tetrahydro-1,2,4,6-tetrazocine (PubChem CID 141031580) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is 3-methyl-5-(2-methylpropyl)-3,4,7,8-tetrahydro-1,2,4,6-tetrazocine.
| Compound Name | 3-methyl-5-(2-methylpropyl)-3,4,7,8-tetrahydro-1,2,4,6-tetrazocine |
|---|---|
| PubChem CID | 141031580 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 3-methyl-5-(2-methylpropyl)-3,4,7,8-tetrahydro-1,2,4,6-tetrazocine |
| SMILES | CC(C)C/C1=N/CC/N=N\C(C)N1 |
| InChI | InChI=1S/C9H18N4/c1-7(2)6-9-10-4-5-11-13-8(3)12-9/h7-8H,4-6H2,1-3H3,(H,10,12)/b13-11- |
| InChIKey | ICRNBFXVAURMKZ-QBFSEMIESA-N |
| XLogP | 1.83 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |