C25H30N2O2 — CID 141032395
2-[4-[1-(3-methylbutyl)indol-3-yl]piperidin-1-yl]benzoic acid (PubChem CID 141032395) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 2-[4-[1-(3-methylbutyl)indol-3-yl]piperidin-1-yl]benzoic acid.
| Compound Name | 2-[4-[1-(3-methylbutyl)indol-3-yl]piperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 141032395 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 2-[4-[1-(3-methylbutyl)indol-3-yl]piperidin-1-yl]benzoic acid |
| SMILES | CC(C)CCn1cc(C2CCN(c3ccccc3C(=O)O)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H30N2O2/c1-18(2)11-14-27-17-22(20-7-3-5-9-23(20)27)19-12-15-26(16-13-19)24-10-6-4-8-21(24)25(28)29/h3-10,17-19H,11-16H2,1-2H3,(H,28,29) |
| InChIKey | ILAGFNNURMCAMN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |