About 1-(2,3-dihydro-1,4-benzodioxin-5-yl)piperidin-2-amine
1-(2,3-dihydro-1,4-benzodioxin-5-yl)piperidin-2-amine (PubChem CID 141032504) has the molecular formula C13H18N2O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-5-yl)piperidin-2-amine.
Molecular Properties
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-5-yl)piperidin-2-amine |
| PubChem CID | 141032504 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-5-yl)piperidin-2-amine |
| SMILES | NC1CCCCN1c1cccc2c1OCCO2 |
| InChI | InChI=1S/C13H18N2O2/c14-12-6-1-2-7-15(12)10-4-3-5-11-13(10)17-9-8-16-11/h3-5,12H,1-2,6-9,14H2 |
| InChIKey | JFPOGSWFMJOPGG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,3-dihydro-1,4-benzodioxin-5-yl)piperidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydro-1,4-benzodioxin-5-yl)piperidin-2-amine?
The IUPAC name of 1-(2,3-dihydro-1,4-benzodioxin-5-yl)piperidin-2-amine (CID 141032504) is 1-(2,3-dihydro-1,4-benzodioxin-5-yl)piperidin-2-amine.
What is the SMILES notation for 1-(2,3-dihydro-1,4-benzodioxin-5-yl)piperidin-2-amine?
The canonical SMILES for 1-(2,3-dihydro-1,4-benzodioxin-5-yl)piperidin-2-amine is NC1CCCCN1c1cccc2c1OCCO2.
What is the InChIKey of 1-(2,3-dihydro-1,4-benzodioxin-5-yl)piperidin-2-amine?
The InChIKey is JFPOGSWFMJOPGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2/c14-12-6-1-2-7-15(12)10-4-3-5-11-13(10)17-9-8-16-11/h3-5,12H,1-2,6-9,14H2.
What are the key properties of 1-(2,3-dihydro-1,4-benzodioxin-5-yl)piperidin-2-amine?
1-(2,3-dihydro-1,4-benzodioxin-5-yl)piperidin-2-amine has a molecular weight of 234.30 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydro-1,4-benzodioxin-5-yl)piperidin-2-amine is sourced from PubChem (CID 141032504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).