About 7-but-3-enyl-7-prop-2-ynylundeca-1,9-dien-5-yne
7-but-3-enyl-7-prop-2-ynylundeca-1,9-dien-5-yne (PubChem CID 141032703) has the molecular formula C18H24
and a molecular weight of 240.39 g/mol. Its IUPAC name is 7-but-3-enyl-7-prop-2-ynylundeca-1,9-dien-5-yne.
Molecular Properties
| Compound Name | 7-but-3-enyl-7-prop-2-ynylundeca-1,9-dien-5-yne |
| PubChem CID | 141032703 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 7-but-3-enyl-7-prop-2-ynylundeca-1,9-dien-5-yne |
| SMILES | C#CCC(C#CCCC=C)(CC=CC)CCC=C |
| InChI | InChI=1S/C18H24/c1-5-9-12-13-17-18(14-8-4,15-10-6-2)16-11-7-3/h4-7,11H,1-2,9-10,12,14-16H2,3H3 |
| InChIKey | BRFVQYNWWIJWGX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-but-3-enyl-7-prop-2-ynylundeca-1,9-dien-5-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-but-3-enyl-7-prop-2-ynylundeca-1,9-dien-5-yne?
The IUPAC name of 7-but-3-enyl-7-prop-2-ynylundeca-1,9-dien-5-yne (CID 141032703) is 7-but-3-enyl-7-prop-2-ynylundeca-1,9-dien-5-yne.
What is the SMILES notation for 7-but-3-enyl-7-prop-2-ynylundeca-1,9-dien-5-yne?
The canonical SMILES for 7-but-3-enyl-7-prop-2-ynylundeca-1,9-dien-5-yne is C#CCC(C#CCCC=C)(CC=CC)CCC=C.
What is the InChIKey of 7-but-3-enyl-7-prop-2-ynylundeca-1,9-dien-5-yne?
The InChIKey is BRFVQYNWWIJWGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24/c1-5-9-12-13-17-18(14-8-4,15-10-6-2)16-11-7-3/h4-7,11H,1-2,9-10,12,14-16H2,3H3.
What are the key properties of 7-but-3-enyl-7-prop-2-ynylundeca-1,9-dien-5-yne?
7-but-3-enyl-7-prop-2-ynylundeca-1,9-dien-5-yne has a molecular weight of 240.39 g/mol, XLogP of 4.90, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-but-3-enyl-7-prop-2-ynylundeca-1,9-dien-5-yne is sourced from PubChem (CID 141032703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).