C15H22O2Si — CID 141032948
1-triethylsilyloxy-1,2-dihydroinden-4-one (PubChem CID 141032948) has the molecular formula C15H22O2Si and a molecular weight of 262.42 g/mol. Its IUPAC name is 1-triethylsilyloxy-1,2-dihydroinden-4-one.
| Compound Name | 1-triethylsilyloxy-1,2-dihydroinden-4-one |
|---|---|
| PubChem CID | 141032948 |
| Molecular Formula | C15H22O2Si |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 1-triethylsilyloxy-1,2-dihydroinden-4-one |
| SMILES | CC[Si](CC)(CC)OC1CC=C2C(=O)C=CC=C21 |
| InChI | InChI=1S/C15H22O2Si/c1-4-18(5-2,6-3)17-15-11-10-12-13(15)8-7-9-14(12)16/h7-10,15H,4-6,11H2,1-3H3 |
| InChIKey | XKCHRINYKXVGAN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|