C12H12F7NO — CID 141033075
3-amino-4,4,5,5,6,6,6-heptafluoro-1-phenylhexan-3-ol (PubChem CID 141033075) has the molecular formula C12H12F7NO and a molecular weight of 319.22 g/mol. Its IUPAC name is 3-amino-4,4,5,5,6,6,6-heptafluoro-1-phenylhexan-3-ol.
| Compound Name | 3-amino-4,4,5,5,6,6,6-heptafluoro-1-phenylhexan-3-ol |
|---|---|
| PubChem CID | 141033075 |
| Molecular Formula | C12H12F7NO |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 3-amino-4,4,5,5,6,6,6-heptafluoro-1-phenylhexan-3-ol |
| SMILES | NC(O)(CCc1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H12F7NO/c13-10(14,11(15,16)12(17,18)19)9(20,21)7-6-8-4-2-1-3-5-8/h1-5,21H,6-7,20H2 |
| InChIKey | NNIZOEKXOHLZBA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|