About 5-phenyl-4H-1,3-oxazine
5-phenyl-4H-1,3-oxazine (PubChem CID 141033738) has the molecular formula C10H9NO
and a molecular weight of 159.19 g/mol. Its IUPAC name is 5-phenyl-4H-1,3-oxazine.
Molecular Properties
| Compound Name | 5-phenyl-4H-1,3-oxazine |
| PubChem CID | 141033738 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 5-phenyl-4H-1,3-oxazine |
| SMILES | C1=NCC(c2ccccc2)=CO1 |
| InChI | InChI=1S/C10H9NO/c1-2-4-9(5-3-1)10-6-11-8-12-7-10/h1-5,7-8H,6H2 |
| InChIKey | INOVJXWCWVOVLC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-phenyl-4H-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-4H-1,3-oxazine?
The IUPAC name of 5-phenyl-4H-1,3-oxazine (CID 141033738) is 5-phenyl-4H-1,3-oxazine.
What is the SMILES notation for 5-phenyl-4H-1,3-oxazine?
The canonical SMILES for 5-phenyl-4H-1,3-oxazine is C1=NCC(c2ccccc2)=CO1.
What is the InChIKey of 5-phenyl-4H-1,3-oxazine?
The InChIKey is INOVJXWCWVOVLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO/c1-2-4-9(5-3-1)10-6-11-8-12-7-10/h1-5,7-8H,6H2.
What are the key properties of 5-phenyl-4H-1,3-oxazine?
5-phenyl-4H-1,3-oxazine has a molecular weight of 159.19 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-4H-1,3-oxazine is sourced from PubChem (CID 141033738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).