About 2,4-dihydro-1H-pyrido[4,3-d][1,3]oxazine
2,4-dihydro-1H-pyrido[4,3-d][1,3]oxazine (PubChem CID 141034032) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is 2,4-dihydro-1H-pyrido[4,3-d][1,3]oxazine.
Molecular Properties
| Compound Name | 2,4-dihydro-1H-pyrido[4,3-d][1,3]oxazine |
| PubChem CID | 141034032 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 2,4-dihydro-1H-pyrido[4,3-d][1,3]oxazine |
| SMILES | c1cc2c(cn1)COCN2 |
| InChI | InChI=1S/C7H8N2O/c1-2-8-3-6-4-10-5-9-7(1)6/h1-3,9H,4-5H2 |
| InChIKey | YCMIHNWNQKSUFU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dihydro-1H-pyrido[4,3-d][1,3]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dihydro-1H-pyrido[4,3-d][1,3]oxazine?
The IUPAC name of 2,4-dihydro-1H-pyrido[4,3-d][1,3]oxazine (CID 141034032) is 2,4-dihydro-1H-pyrido[4,3-d][1,3]oxazine.
What is the SMILES notation for 2,4-dihydro-1H-pyrido[4,3-d][1,3]oxazine?
The canonical SMILES for 2,4-dihydro-1H-pyrido[4,3-d][1,3]oxazine is c1cc2c(cn1)COCN2.
What is the InChIKey of 2,4-dihydro-1H-pyrido[4,3-d][1,3]oxazine?
The InChIKey is YCMIHNWNQKSUFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O/c1-2-8-3-6-4-10-5-9-7(1)6/h1-3,9H,4-5H2.
What are the key properties of 2,4-dihydro-1H-pyrido[4,3-d][1,3]oxazine?
2,4-dihydro-1H-pyrido[4,3-d][1,3]oxazine has a molecular weight of 136.15 g/mol, XLogP of 0.98, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydro-1H-pyrido[4,3-d][1,3]oxazine is sourced from PubChem (CID 141034032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).