C18H28O2 — CID 141034271
(E,5S)-1-(2-hydroxy-2,3,6,6a-tetrahydro-1H-pentalen-3a-yl)-5-methylnon-1-en-3-one (PubChem CID 141034271) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (E,5S)-1-(2-hydroxy-2,3,6,6a-tetrahydro-1H-pentalen-3a-yl)-5-methylnon-1-en-3-one.
| Compound Name | (E,5S)-1-(2-hydroxy-2,3,6,6a-tetrahydro-1H-pentalen-3a-yl)-5-methylnon-1-en-3-one |
|---|---|
| PubChem CID | 141034271 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (E,5S)-1-(2-hydroxy-2,3,6,6a-tetrahydro-1H-pentalen-3a-yl)-5-methylnon-1-en-3-one |
| SMILES | CCCC[C@H](C)CC(=O)/C=C/C12C=CCC1CC(O)C2 |
| InChI | InChI=1S/C18H28O2/c1-3-4-6-14(2)11-16(19)8-10-18-9-5-7-15(18)12-17(20)13-18/h5,8-10,14-15,17,20H,3-4,6-7,11-13H2,1-2H3/b10-8+/t14-,15?,17?,18?/m0/s1 |
| InChIKey | YRQOLGAPZOMHLO-NSOMZXOPSA-N |
| XLogP | 4.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|