About [2-(3-chlorophenyl)-2-oxoethyl] propyl carbonate
[2-(3-chlorophenyl)-2-oxoethyl] propyl carbonate (PubChem CID 141034666) has the molecular formula C12H13ClO4
and a molecular weight of 256.69 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-2-oxoethyl] propyl carbonate.
Molecular Properties
| Compound Name | [2-(3-chlorophenyl)-2-oxoethyl] propyl carbonate |
| PubChem CID | 141034666 |
| Molecular Formula | C12H13ClO4 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | [2-(3-chlorophenyl)-2-oxoethyl] propyl carbonate |
| SMILES | CCCOC(=O)OCC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H13ClO4/c1-2-6-16-12(15)17-8-11(14)9-4-3-5-10(13)7-9/h3-5,7H,2,6,8H2,1H3 |
| InChIKey | FWLNSWRDGQJRQB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(3-chlorophenyl)-2-oxoethyl] propyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-chlorophenyl)-2-oxoethyl] propyl carbonate?
The IUPAC name of [2-(3-chlorophenyl)-2-oxoethyl] propyl carbonate (CID 141034666) is [2-(3-chlorophenyl)-2-oxoethyl] propyl carbonate.
What is the SMILES notation for [2-(3-chlorophenyl)-2-oxoethyl] propyl carbonate?
The canonical SMILES for [2-(3-chlorophenyl)-2-oxoethyl] propyl carbonate is CCCOC(=O)OCC(=O)c1cccc(Cl)c1.
What is the InChIKey of [2-(3-chlorophenyl)-2-oxoethyl] propyl carbonate?
The InChIKey is FWLNSWRDGQJRQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClO4/c1-2-6-16-12(15)17-8-11(14)9-4-3-5-10(13)7-9/h3-5,7H,2,6,8H2,1H3.
What are the key properties of [2-(3-chlorophenyl)-2-oxoethyl] propyl carbonate?
[2-(3-chlorophenyl)-2-oxoethyl] propyl carbonate has a molecular weight of 256.69 g/mol, XLogP of 3.09, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-chlorophenyl)-2-oxoethyl] propyl carbonate is sourced from PubChem (CID 141034666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).