C20H17N3O2 — CID 141034768
2-(furan-2-yl)-7-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 141034768) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-(furan-2-yl)-7-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-(furan-2-yl)-7-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 141034768 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2-(furan-2-yl)-7-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | c1coc(-c2nc3cc(Oc4ccc5c(c4)CCCC5)ccn3n2)c1 |
| InChI | InChI=1S/C20H17N3O2/c1-2-5-15-12-16(8-7-14(15)4-1)25-17-9-10-23-19(13-17)21-20(22-23)18-6-3-11-24-18/h3,6-13H,1-2,4-5H2 |
| InChIKey | PBTGZSGRTQMOBV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 52.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |