C14H19BrO3 — CID 141035219
[4-(2-bromopropanoyl)-6,6-dimethylcyclohexa-2,4-dien-1-yl] propanoate (PubChem CID 141035219) has the molecular formula C14H19BrO3 and a molecular weight of 315.21 g/mol. Its IUPAC name is [4-(2-bromopropanoyl)-6,6-dimethylcyclohexa-2,4-dien-1-yl] propanoate.
| Compound Name | [4-(2-bromopropanoyl)-6,6-dimethylcyclohexa-2,4-dien-1-yl] propanoate |
|---|---|
| PubChem CID | 141035219 |
| Molecular Formula | C14H19BrO3 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | [4-(2-bromopropanoyl)-6,6-dimethylcyclohexa-2,4-dien-1-yl] propanoate |
| SMILES | CCC(=O)OC1C=CC(C(=O)C(C)Br)=CC1(C)C |
| InChI | InChI=1S/C14H19BrO3/c1-5-12(16)18-11-7-6-10(8-14(11,3)4)13(17)9(2)15/h6-9,11H,5H2,1-4H3 |
| InChIKey | JUFRXSCPJJXMOQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|