C25H33NO2S — CID 141035548
4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-6-(1,3-thiazolidin-5-ylmethyl)benzene-1,3-diol (PubChem CID 141035548) has the molecular formula C25H33NO2S and a molecular weight of 411.61 g/mol. Its IUPAC name is 4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-6-(1,3-thiazolidin-5-ylmethyl)benzene-1,3-diol.
| Compound Name | 4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-6-(1,3-thiazolidin-5-ylmethyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 141035548 |
| Molecular Formula | C25H33NO2S |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-6-(1,3-thiazolidin-5-ylmethyl)benzene-1,3-diol |
| SMILES | Cc1cc2c(cc1-c1cc(CC3CNCS3)c(O)cc1O)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H33NO2S/c1-15-8-20-21(25(4,5)7-6-24(20,2)3)11-18(15)19-10-16(22(27)12-23(19)28)9-17-13-26-14-29-17/h8,10-12,17,26-28H,6-7,9,13-14H2,1-5H3 |
| InChIKey | PQYKIVCKWHFZLJ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |