About 3-dodecylazepin-2-one
3-dodecylazepin-2-one (PubChem CID 141035638) has the molecular formula C18H29NO
and a molecular weight of 275.44 g/mol. Its IUPAC name is 3-dodecylazepin-2-one.
Molecular Properties
| Compound Name | 3-dodecylazepin-2-one |
| PubChem CID | 141035638 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 3-dodecylazepin-2-one |
| SMILES | CCCCCCCCCCCCc1ccccnc1=O |
| InChI | InChI=1S/C18H29NO/c1-2-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16-19-18(17)20/h12-13,15-16H,2-11,14H2,1H3 |
| InChIKey | DPPKHDNNSNHRRD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-dodecylazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dodecylazepin-2-one?
The IUPAC name of 3-dodecylazepin-2-one (CID 141035638) is 3-dodecylazepin-2-one.
What is the SMILES notation for 3-dodecylazepin-2-one?
The canonical SMILES for 3-dodecylazepin-2-one is CCCCCCCCCCCCc1ccccnc1=O.
What is the InChIKey of 3-dodecylazepin-2-one?
The InChIKey is DPPKHDNNSNHRRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO/c1-2-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16-19-18(17)20/h12-13,15-16H,2-11,14H2,1H3.
What are the key properties of 3-dodecylazepin-2-one?
3-dodecylazepin-2-one has a molecular weight of 275.44 g/mol, XLogP of 4.91, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dodecylazepin-2-one is sourced from PubChem (CID 141035638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).