C17H27NO3 — CID 141035749
2-benzyl-2-(hydroxymethoxy)nonanamide (PubChem CID 141035749) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-benzyl-2-(hydroxymethoxy)nonanamide.
| Compound Name | 2-benzyl-2-(hydroxymethoxy)nonanamide |
|---|---|
| PubChem CID | 141035749 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 2-benzyl-2-(hydroxymethoxy)nonanamide |
| SMILES | CCCCCCCC(Cc1ccccc1)(OCO)C(N)=O |
| InChI | InChI=1S/C17H27NO3/c1-2-3-4-5-9-12-17(16(18)20,21-14-19)13-15-10-7-6-8-11-15/h6-8,10-11,19H,2-5,9,12-14H2,1H3,(H2,18,20) |
| InChIKey | ANCSTBJESYKXLQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|