C19H24N2O — CID 141035791
(2S,3S)-2-[methoxy(phenyl)methyl]-2-phenylpiperidin-3-amine (PubChem CID 141035791) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is (2S,3S)-2-[methoxy(phenyl)methyl]-2-phenylpiperidin-3-amine.
| Compound Name | (2S,3S)-2-[methoxy(phenyl)methyl]-2-phenylpiperidin-3-amine |
|---|---|
| PubChem CID | 141035791 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | (2S,3S)-2-[methoxy(phenyl)methyl]-2-phenylpiperidin-3-amine |
| SMILES | COC(c1ccccc1)[C@@]1(c2ccccc2)NCCC[C@@H]1N |
| InChI | InChI=1S/C19H24N2O/c1-22-18(15-9-4-2-5-10-15)19(16-11-6-3-7-12-16)17(20)13-8-14-21-19/h2-7,9-12,17-18,21H,8,13-14,20H2,1H3/t17-,18?,19-/m0/s1 |
| InChIKey | BAAIMHARSSVXDL-JVUMBYKBSA-N |
| XLogP | 2.98 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |