C6H9NS — CID 141035957
2,4-dimethyl-2H-1,3-thiazine (PubChem CID 141035957) has the molecular formula C6H9NS and a molecular weight of 127.21 g/mol. Its IUPAC name is 2,4-dimethyl-2H-1,3-thiazine.
| Compound Name | 2,4-dimethyl-2H-1,3-thiazine |
|---|---|
| PubChem CID | 141035957 |
| Molecular Formula | C6H9NS |
| Molecular Weight | 127.21 g/mol |
| Exact Mass | 127.05 |
| IUPAC Name | 2,4-dimethyl-2H-1,3-thiazine |
| SMILES | CC1=NC(C)SC=C1 |
| InChI | InChI=1S/C6H9NS/c1-5-3-4-8-6(2)7-5/h3-4,6H,1-2H3 |
| InChIKey | DPHAHKZETCTUTF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |