About 2-methyl-1-propoxy-9-(trifluoromethyl)pyrido[3,2-g][1,4]benzoxazine
2-methyl-1-propoxy-9-(trifluoromethyl)pyrido[3,2-g][1,4]benzoxazine (PubChem CID 141036477) has the molecular formula C16H15F3N2O2
and a molecular weight of 324.30 g/mol. Its IUPAC name is 2-methyl-1-propoxy-9-(trifluoromethyl)pyrido[3,2-g][1,4]benzoxazine.
Molecular Properties
| Compound Name | 2-methyl-1-propoxy-9-(trifluoromethyl)pyrido[3,2-g][1,4]benzoxazine |
| PubChem CID | 141036477 |
| Molecular Formula | C16H15F3N2O2 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-methyl-1-propoxy-9-(trifluoromethyl)pyrido[3,2-g][1,4]benzoxazine |
| SMILES | CCCON1C(C)=COc2cc3nccc(C(F)(F)F)c3cc21 |
| InChI | InChI=1S/C16H15F3N2O2/c1-3-6-23-21-10(2)9-22-15-8-13-11(7-14(15)21)12(4-5-20-13)16(17,18)19/h4-5,7-9H,3,6H2,1-2H3 |
| InChIKey | XOUOAFAPLNMPOE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-1-propoxy-9-(trifluoromethyl)pyrido[3,2-g][1,4]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-propoxy-9-(trifluoromethyl)pyrido[3,2-g][1,4]benzoxazine?
The IUPAC name of 2-methyl-1-propoxy-9-(trifluoromethyl)pyrido[3,2-g][1,4]benzoxazine (CID 141036477) is 2-methyl-1-propoxy-9-(trifluoromethyl)pyrido[3,2-g][1,4]benzoxazine.
What is the SMILES notation for 2-methyl-1-propoxy-9-(trifluoromethyl)pyrido[3,2-g][1,4]benzoxazine?
The canonical SMILES for 2-methyl-1-propoxy-9-(trifluoromethyl)pyrido[3,2-g][1,4]benzoxazine is CCCON1C(C)=COc2cc3nccc(C(F)(F)F)c3cc21.
What is the InChIKey of 2-methyl-1-propoxy-9-(trifluoromethyl)pyrido[3,2-g][1,4]benzoxazine?
The InChIKey is XOUOAFAPLNMPOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F3N2O2/c1-3-6-23-21-10(2)9-22-15-8-13-11(7-14(15)21)12(4-5-20-13)16(17,18)19/h4-5,7-9H,3,6H2,1-2H3.
What are the key properties of 2-methyl-1-propoxy-9-(trifluoromethyl)pyrido[3,2-g][1,4]benzoxazine?
2-methyl-1-propoxy-9-(trifluoromethyl)pyrido[3,2-g][1,4]benzoxazine has a molecular weight of 324.30 g/mol, XLogP of 4.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-propoxy-9-(trifluoromethyl)pyrido[3,2-g][1,4]benzoxazine is sourced from PubChem (CID 141036477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).