C11H10O4 — CID 141037512
2,4-dimethoxy-3-prop-2-ynoxy-7-oxabicyclo[4.1.0]hepta-1,3,5-triene (PubChem CID 141037512) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is 2,4-dimethoxy-3-prop-2-ynoxy-7-oxabicyclo[4.1.0]hepta-1,3,5-triene.
| Compound Name | 2,4-dimethoxy-3-prop-2-ynoxy-7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 141037512 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 2,4-dimethoxy-3-prop-2-ynoxy-7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
| SMILES | C#CCOc1c(OC)cc2c(c1OC)O2 |
| InChI | InChI=1S/C11H10O4/c1-4-5-14-9-7(12-2)6-8-10(15-8)11(9)13-3/h1,6H,5H2,2-3H3 |
| InChIKey | CLMJFIPIUJTFHI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|