C8H14Na2O5S — CID 141037717
disodium;4-(2-sulfoethyl)cyclohexane-1,2-diolate (PubChem CID 141037717) has the molecular formula C8H14Na2O5S and a molecular weight of 268.24 g/mol. Its IUPAC name is disodium;4-(2-sulfoethyl)cyclohexane-1,2-diolate.
| Compound Name | disodium;4-(2-sulfoethyl)cyclohexane-1,2-diolate |
|---|---|
| PubChem CID | 141037717 |
| Molecular Formula | C8H14Na2O5S |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | disodium;4-(2-sulfoethyl)cyclohexane-1,2-diolate |
| SMILES | O=S(=O)(O)CCC1CCC([O-])C([O-])C1.[Na+].[Na+] |
| InChI | InChI=1S/C8H14O5S.2Na/c9-7-2-1-6(5-8(7)10)3-4-14(11,12)13;;/h6-8H,1-5H2,(H,11,12,13);;/q-2;2*+1 |
| InChIKey | HWYPANKFVGODPH-UHFFFAOYSA-N |
| XLogP | -7.47 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | -7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|