C16H24FN3O3 — CID 141038480
2-[4-[4-(4-fluorophenoxy)-2-hydroxybutyl]piperazin-1-yl]acetamide (PubChem CID 141038480) has the molecular formula C16H24FN3O3 and a molecular weight of 325.38 g/mol. Its IUPAC name is 2-[4-[4-(4-fluorophenoxy)-2-hydroxybutyl]piperazin-1-yl]acetamide.
| Compound Name | 2-[4-[4-(4-fluorophenoxy)-2-hydroxybutyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 141038480 |
| Molecular Formula | C16H24FN3O3 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-[4-[4-(4-fluorophenoxy)-2-hydroxybutyl]piperazin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCN(CC(O)CCOc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H24FN3O3/c17-13-1-3-15(4-2-13)23-10-5-14(21)11-19-6-8-20(9-7-19)12-16(18)22/h1-4,14,21H,5-12H2,(H2,18,22) |
| InChIKey | CJVUDBIOSKYWLN-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |