C11H14N2O3 — CID 141038558
(Z)-(2,7-dimethyl-3,6-dioxoocta-1,7-dien-4-ylidene)urea (PubChem CID 141038558) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is (Z)-(2,7-dimethyl-3,6-dioxoocta-1,7-dien-4-ylidene)urea.
| Compound Name | (Z)-(2,7-dimethyl-3,6-dioxoocta-1,7-dien-4-ylidene)urea |
|---|---|
| PubChem CID | 141038558 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (Z)-(2,7-dimethyl-3,6-dioxoocta-1,7-dien-4-ylidene)urea |
| SMILES | C=C(C)C(=O)C/C(=N/C(N)=O)C(=O)C(=C)C |
| InChI | InChI=1S/C11H14N2O3/c1-6(2)9(14)5-8(13-11(12)16)10(15)7(3)4/h1,3,5H2,2,4H3,(H2,12,16)/b13-8- |
| InChIKey | PMJAPWMQPSYNDL-JYRVWZFOSA-N |
| XLogP | 1.19 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|