About 2-ethoxy-N,N-dimethyl-3-oxopent-4-enamide
2-ethoxy-N,N-dimethyl-3-oxopent-4-enamide (PubChem CID 141038560) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is 2-ethoxy-N,N-dimethyl-3-oxopent-4-enamide.
Molecular Properties
| Compound Name | 2-ethoxy-N,N-dimethyl-3-oxopent-4-enamide |
| PubChem CID | 141038560 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 2-ethoxy-N,N-dimethyl-3-oxopent-4-enamide |
| SMILES | C=CC(=O)C(OCC)C(=O)N(C)C |
| InChI | InChI=1S/C9H15NO3/c1-5-7(11)8(13-6-2)9(12)10(3)4/h5,8H,1,6H2,2-4H3 |
| InChIKey | MWASOBNDIFAJNL-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-N,N-dimethyl-3-oxopent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-N,N-dimethyl-3-oxopent-4-enamide?
The IUPAC name of 2-ethoxy-N,N-dimethyl-3-oxopent-4-enamide (CID 141038560) is 2-ethoxy-N,N-dimethyl-3-oxopent-4-enamide.
What is the SMILES notation for 2-ethoxy-N,N-dimethyl-3-oxopent-4-enamide?
The canonical SMILES for 2-ethoxy-N,N-dimethyl-3-oxopent-4-enamide is C=CC(=O)C(OCC)C(=O)N(C)C.
What is the InChIKey of 2-ethoxy-N,N-dimethyl-3-oxopent-4-enamide?
The InChIKey is MWASOBNDIFAJNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-5-7(11)8(13-6-2)9(12)10(3)4/h5,8H,1,6H2,2-4H3.
What are the key properties of 2-ethoxy-N,N-dimethyl-3-oxopent-4-enamide?
2-ethoxy-N,N-dimethyl-3-oxopent-4-enamide has a molecular weight of 185.22 g/mol, XLogP of 0.23, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-N,N-dimethyl-3-oxopent-4-enamide is sourced from PubChem (CID 141038560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).