About 2H-azepine-6-carboxamide
2H-azepine-6-carboxamide (PubChem CID 141039340) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is 2H-azepine-6-carboxamide.
Molecular Properties
| Compound Name | 2H-azepine-6-carboxamide |
| PubChem CID | 141039340 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 2H-azepine-6-carboxamide |
| SMILES | NC(=O)C1=CC=CCN=C1 |
| InChI | InChI=1S/C7H8N2O/c8-7(10)6-3-1-2-4-9-5-6/h1-3,5H,4H2,(H2,8,10) |
| InChIKey | QNOXPPYDIGSVKW-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-azepine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-azepine-6-carboxamide?
The IUPAC name of 2H-azepine-6-carboxamide (CID 141039340) is 2H-azepine-6-carboxamide.
What is the SMILES notation for 2H-azepine-6-carboxamide?
The canonical SMILES for 2H-azepine-6-carboxamide is NC(=O)C1=CC=CCN=C1.
What is the InChIKey of 2H-azepine-6-carboxamide?
The InChIKey is QNOXPPYDIGSVKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O/c8-7(10)6-3-1-2-4-9-5-6/h1-3,5H,4H2,(H2,8,10).
What are the key properties of 2H-azepine-6-carboxamide?
2H-azepine-6-carboxamide has a molecular weight of 136.15 g/mol, XLogP of 0.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-azepine-6-carboxamide is sourced from PubChem (CID 141039340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).