About ethyl acetate;trihydrochloride
ethyl acetate;trihydrochloride (PubChem CID 141039771) has the molecular formula C4H11Cl3O2
and a molecular weight of 197.49 g/mol. Its IUPAC name is ethyl acetate;trihydrochloride.
Molecular Properties
| Compound Name | ethyl acetate;trihydrochloride |
| PubChem CID | 141039771 |
| Molecular Formula | C4H11Cl3O2 |
| Molecular Weight | 197.49 g/mol |
| Exact Mass | 195.98 |
| IUPAC Name | ethyl acetate;trihydrochloride |
| SMILES | CCOC(C)=O.Cl.Cl.Cl |
| InChI | InChI=1S/C4H8O2.3ClH/c1-3-6-4(2)5;;;/h3H2,1-2H3;3*1H |
| InChIKey | PFEUZLFSGHADLO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl acetate;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl acetate;trihydrochloride?
The IUPAC name of ethyl acetate;trihydrochloride (CID 141039771) is ethyl acetate;trihydrochloride.
What is the SMILES notation for ethyl acetate;trihydrochloride?
The canonical SMILES for ethyl acetate;trihydrochloride is CCOC(C)=O.Cl.Cl.Cl.
What is the InChIKey of ethyl acetate;trihydrochloride?
The InChIKey is PFEUZLFSGHADLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.3ClH/c1-3-6-4(2)5;;;/h3H2,1-2H3;3*1H.
What are the key properties of ethyl acetate;trihydrochloride?
ethyl acetate;trihydrochloride has a molecular weight of 197.49 g/mol, XLogP of 1.83, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl acetate;trihydrochloride is sourced from PubChem (CID 141039771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).