About 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid;hydrochloride
1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid;hydrochloride (PubChem CID 141040715) has the molecular formula C10H6ClF2NO4
and a molecular weight of 277.61 g/mol. Its IUPAC name is 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid;hydrochloride |
| PubChem CID | 141040715 |
| Molecular Formula | C10H6ClF2NO4 |
| Molecular Weight | 277.61 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C1C(=O)C(C(=O)O)N(F)c2cccc(F)c21 |
| InChI | InChI=1S/C10H5F2NO4.ClH/c11-4-2-1-3-5-6(4)8(14)9(15)7(10(16)17)13(5)12;/h1-3,7H,(H,16,17);1H |
| InChIKey | KYABMBDXOHNQHV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.61 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid;hydrochloride?
The IUPAC name of 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid;hydrochloride (CID 141040715) is 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid;hydrochloride.
What is the SMILES notation for 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid;hydrochloride?
The canonical SMILES for 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid;hydrochloride is Cl.O=C1C(=O)C(C(=O)O)N(F)c2cccc(F)c21.
What is the InChIKey of 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid;hydrochloride?
The InChIKey is KYABMBDXOHNQHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F2NO4.ClH/c11-4-2-1-3-5-6(4)8(14)9(15)7(10(16)17)13(5)12;/h1-3,7H,(H,16,17);1H.
What are the key properties of 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid;hydrochloride?
1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid;hydrochloride has a molecular weight of 277.61 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid;hydrochloride is sourced from PubChem (CID 141040715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).