About bis(3-chloro-2,4-diethyl-1H-inden-1-yl)-dimethylsilane
bis(3-chloro-2,4-diethyl-1H-inden-1-yl)-dimethylsilane (PubChem CID 141041106) has the molecular formula C28H34Cl2Si
and a molecular weight of 469.57 g/mol. Its IUPAC name is bis(3-chloro-2,4-diethyl-1H-inden-1-yl)-dimethylsilane.
Molecular Properties
| Compound Name | bis(3-chloro-2,4-diethyl-1H-inden-1-yl)-dimethylsilane |
| PubChem CID | 141041106 |
| Molecular Formula | C28H34Cl2Si |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | bis(3-chloro-2,4-diethyl-1H-inden-1-yl)-dimethylsilane |
| SMILES | CCC1=C(Cl)c2c(CC)cccc2C1[Si](C)(C)C1C(CC)=C(Cl)c2c(CC)cccc21 |
| InChI | InChI=1S/C28H34Cl2Si/c1-7-17-13-11-15-21-23(17)25(29)19(9-3)27(21)31(5,6)28-20(10-4)26(30)24-18(8-2)14-12-16-22(24)28/h11-16,27-28H,7-10H2,1-6H3 |
| InChIKey | OWDBAYBBVXMTJR-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(3-chloro-2,4-diethyl-1H-inden-1-yl)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-chloro-2,4-diethyl-1H-inden-1-yl)-dimethylsilane?
The IUPAC name of bis(3-chloro-2,4-diethyl-1H-inden-1-yl)-dimethylsilane (CID 141041106) is bis(3-chloro-2,4-diethyl-1H-inden-1-yl)-dimethylsilane.
What is the SMILES notation for bis(3-chloro-2,4-diethyl-1H-inden-1-yl)-dimethylsilane?
The canonical SMILES for bis(3-chloro-2,4-diethyl-1H-inden-1-yl)-dimethylsilane is CCC1=C(Cl)c2c(CC)cccc2C1[Si](C)(C)C1C(CC)=C(Cl)c2c(CC)cccc21.
What is the InChIKey of bis(3-chloro-2,4-diethyl-1H-inden-1-yl)-dimethylsilane?
The InChIKey is OWDBAYBBVXMTJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34Cl2Si/c1-7-17-13-11-15-21-23(17)25(29)19(9-3)27(21)31(5,6)28-20(10-4)26(30)24-18(8-2)14-12-16-22(24)28/h11-16,27-28H,7-10H2,1-6H3.
What are the key properties of bis(3-chloro-2,4-diethyl-1H-inden-1-yl)-dimethylsilane?
bis(3-chloro-2,4-diethyl-1H-inden-1-yl)-dimethylsilane has a molecular weight of 469.57 g/mol, XLogP of 9.21, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-chloro-2,4-diethyl-1H-inden-1-yl)-dimethylsilane is sourced from PubChem (CID 141041106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).