About tert-butyl (3R)-6-cyclohexyl-3-(5-methyl-1,3-oxazol-2-yl)hexanoate
tert-butyl (3R)-6-cyclohexyl-3-(5-methyl-1,3-oxazol-2-yl)hexanoate (PubChem CID 141041346) has the molecular formula C20H33NO3
and a molecular weight of 335.49 g/mol. Its IUPAC name is tert-butyl (3R)-6-cyclohexyl-3-(5-methyl-1,3-oxazol-2-yl)hexanoate.
Molecular Properties
| Compound Name | tert-butyl (3R)-6-cyclohexyl-3-(5-methyl-1,3-oxazol-2-yl)hexanoate |
| PubChem CID | 141041346 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | tert-butyl (3R)-6-cyclohexyl-3-(5-methyl-1,3-oxazol-2-yl)hexanoate |
| SMILES | Cc1cnc([C@H](CCCC2CCCCC2)CC(=O)OC(C)(C)C)o1 |
| InChI | InChI=1S/C20H33NO3/c1-15-14-21-19(23-15)17(13-18(22)24-20(2,3)4)12-8-11-16-9-6-5-7-10-16/h14,16-17H,5-13H2,1-4H3/t17-/m1/s1 |
| InChIKey | FYUJYWDNKWAMDZ-QGZVFWFLSA-N |
| XLogP | 5.55 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (3R)-6-cyclohexyl-3-(5-methyl-1,3-oxazol-2-yl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3R)-6-cyclohexyl-3-(5-methyl-1,3-oxazol-2-yl)hexanoate?
The IUPAC name of tert-butyl (3R)-6-cyclohexyl-3-(5-methyl-1,3-oxazol-2-yl)hexanoate (CID 141041346) is tert-butyl (3R)-6-cyclohexyl-3-(5-methyl-1,3-oxazol-2-yl)hexanoate.
What is the SMILES notation for tert-butyl (3R)-6-cyclohexyl-3-(5-methyl-1,3-oxazol-2-yl)hexanoate?
The canonical SMILES for tert-butyl (3R)-6-cyclohexyl-3-(5-methyl-1,3-oxazol-2-yl)hexanoate is Cc1cnc([C@H](CCCC2CCCCC2)CC(=O)OC(C)(C)C)o1.
What is the InChIKey of tert-butyl (3R)-6-cyclohexyl-3-(5-methyl-1,3-oxazol-2-yl)hexanoate?
The InChIKey is FYUJYWDNKWAMDZ-QGZVFWFLSA-N. The full InChI is InChI=1S/C20H33NO3/c1-15-14-21-19(23-15)17(13-18(22)24-20(2,3)4)12-8-11-16-9-6-5-7-10-16/h14,16-17H,5-13H2,1-4H3/t17-/m1/s1.
What are the key properties of tert-butyl (3R)-6-cyclohexyl-3-(5-methyl-1,3-oxazol-2-yl)hexanoate?
tert-butyl (3R)-6-cyclohexyl-3-(5-methyl-1,3-oxazol-2-yl)hexanoate has a molecular weight of 335.49 g/mol, XLogP of 5.55, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3R)-6-cyclohexyl-3-(5-methyl-1,3-oxazol-2-yl)hexanoate is sourced from PubChem (CID 141041346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).