About 16,16-diethoxyhexadec-14-enal
16,16-diethoxyhexadec-14-enal (PubChem CID 141041354) has the molecular formula C20H38O3
and a molecular weight of 326.52 g/mol. Its IUPAC name is 16,16-diethoxyhexadec-14-enal.
Molecular Properties
| Compound Name | 16,16-diethoxyhexadec-14-enal |
| PubChem CID | 141041354 |
| Molecular Formula | C20H38O3 |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.28 |
| IUPAC Name | 16,16-diethoxyhexadec-14-enal |
| SMILES | CCOC(C=CCCCCCCCCCCCCC=O)OCC |
| InChI | InChI=1S/C20H38O3/c1-3-22-20(23-4-2)18-16-14-12-10-8-6-5-7-9-11-13-15-17-19-21/h16,18-20H,3-15,17H2,1-2H3 |
| InChIKey | DVTZMILIXVSXRY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 16,16-diethoxyhexadec-14-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 16,16-diethoxyhexadec-14-enal?
The IUPAC name of 16,16-diethoxyhexadec-14-enal (CID 141041354) is 16,16-diethoxyhexadec-14-enal.
What is the SMILES notation for 16,16-diethoxyhexadec-14-enal?
The canonical SMILES for 16,16-diethoxyhexadec-14-enal is CCOC(C=CCCCCCCCCCCCCC=O)OCC.
What is the InChIKey of 16,16-diethoxyhexadec-14-enal?
The InChIKey is DVTZMILIXVSXRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O3/c1-3-22-20(23-4-2)18-16-14-12-10-8-6-5-7-9-11-13-15-17-19-21/h16,18-20H,3-15,17H2,1-2H3.
What are the key properties of 16,16-diethoxyhexadec-14-enal?
16,16-diethoxyhexadec-14-enal has a molecular weight of 326.52 g/mol, XLogP of 5.82, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 16,16-diethoxyhexadec-14-enal is sourced from PubChem (CID 141041354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).