About ethyl 2-formyloxypropanoate
ethyl 2-formyloxypropanoate (PubChem CID 14104142) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is ethyl 2-formyloxypropanoate.
Molecular Properties
| Compound Name | ethyl 2-formyloxypropanoate |
| PubChem CID | 14104142 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | ethyl 2-formyloxypropanoate |
| SMILES | CCOC(=O)C(C)OC=O |
| InChI | InChI=1S/C6H10O4/c1-3-9-6(8)5(2)10-4-7/h4-5H,3H2,1-2H3 |
| InChIKey | AHQYKPUMWRHYQC-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-formyloxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-formyloxypropanoate?
The IUPAC name of ethyl 2-formyloxypropanoate (CID 14104142) is ethyl 2-formyloxypropanoate.
What is the SMILES notation for ethyl 2-formyloxypropanoate?
The canonical SMILES for ethyl 2-formyloxypropanoate is CCOC(=O)C(C)OC=O.
What is the InChIKey of ethyl 2-formyloxypropanoate?
The InChIKey is AHQYKPUMWRHYQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4/c1-3-9-6(8)5(2)10-4-7/h4-5H,3H2,1-2H3.
What are the key properties of ethyl 2-formyloxypropanoate?
ethyl 2-formyloxypropanoate has a molecular weight of 146.14 g/mol, XLogP of 0.11, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-formyloxypropanoate is sourced from PubChem (CID 14104142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).