C16H22O7S — CID 141041618
methyl (1S,3R,4R,5S)-1-(benzenesulfonyloxy)-3-hydroperoxy-4,5-dimethylcyclohexane-1-carboxylate (PubChem CID 141041618) has the molecular formula C16H22O7S and a molecular weight of 358.41 g/mol. Its IUPAC name is methyl (1S,3R,4R,5S)-1-(benzenesulfonyloxy)-3-hydroperoxy-4,5-dimethylcyclohexane-1-carboxylate.
| Compound Name | methyl (1S,3R,4R,5S)-1-(benzenesulfonyloxy)-3-hydroperoxy-4,5-dimethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 141041618 |
| Molecular Formula | C16H22O7S |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | methyl (1S,3R,4R,5S)-1-(benzenesulfonyloxy)-3-hydroperoxy-4,5-dimethylcyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@]1(OS(=O)(=O)c2ccccc2)C[C@H](C)[C@@H](C)[C@H](OO)C1 |
| InChI | InChI=1S/C16H22O7S/c1-11-9-16(15(17)21-3,10-14(22-18)12(11)2)23-24(19,20)13-7-5-4-6-8-13/h4-8,11-12,14,18H,9-10H2,1-3H3/t11-,12+,14+,16-/m0/s1 |
| InChIKey | WADBVXRTZXMWLF-DMEJVMROSA-N |
| XLogP | 2.23 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|