C15H20O6S — CID 141041622
methyl (1S,3S,5S)-1-(benzenesulfonyloxy)-3-hydroxy-5-methylcyclohexane-1-carboxylate (PubChem CID 141041622) has the molecular formula C15H20O6S and a molecular weight of 328.39 g/mol. Its IUPAC name is methyl (1S,3S,5S)-1-(benzenesulfonyloxy)-3-hydroxy-5-methylcyclohexane-1-carboxylate.
| Compound Name | methyl (1S,3S,5S)-1-(benzenesulfonyloxy)-3-hydroxy-5-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 141041622 |
| Molecular Formula | C15H20O6S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | methyl (1S,3S,5S)-1-(benzenesulfonyloxy)-3-hydroxy-5-methylcyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@]1(OS(=O)(=O)c2ccccc2)C[C@@H](C)C[C@H](O)C1 |
| InChI | InChI=1S/C15H20O6S/c1-11-8-12(16)10-15(9-11,14(17)20-2)21-22(18,19)13-6-4-3-5-7-13/h3-7,11-12,16H,8-10H2,1-2H3/t11-,12-,15-/m0/s1 |
| InChIKey | ZWSXFBWNTWIZAK-HUBLWGQQSA-N |
| XLogP | 1.48 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|